C9H7NO4 — CID 88894337
5-nitro-2,3-dihydro-1-benzofuran-2-carbaldehyde (PubChem CID 88894337) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 5-nitro-2,3-dihydro-1-benzofuran-2-carbaldehyde.
| Compound Name | 5-nitro-2,3-dihydro-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 88894337 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 5-nitro-2,3-dihydro-1-benzofuran-2-carbaldehyde |
| SMILES | O=CC1Cc2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C9H7NO4/c11-5-8-4-6-3-7(10(12)13)1-2-9(6)14-8/h1-3,5,8H,4H2 |
| InChIKey | IPLUTAISXDCYMI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|