C14H11NO4 — CID 45117140
6-nitro-2-phenyl-4H-1,3-benzodioxine (PubChem CID 45117140) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 6-nitro-2-phenyl-4H-1,3-benzodioxine.
| Compound Name | 6-nitro-2-phenyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 45117140 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 6-nitro-2-phenyl-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)COC(c1ccccc1)O2 |
| InChI | InChI=1S/C14H11NO4/c16-15(17)12-6-7-13-11(8-12)9-18-14(19-13)10-4-2-1-3-5-10/h1-8,14H,9H2 |
| InChIKey | CYXGIQBCPAGGSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|