C21H16FNO5 — CID 7816926
(2S)-6-fluoro-8-[(4-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine (PubChem CID 7816926) has the molecular formula C21H16FNO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is (2S)-6-fluoro-8-[(4-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine.
| Compound Name | (2S)-6-fluoro-8-[(4-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 7816926 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2S)-6-fluoro-8-[(4-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc(OCc2cc(F)cc3c2O[C@@H](c2ccccc2)OC3)cc1 |
| InChI | InChI=1S/C21H16FNO5/c22-17-10-15(12-26-19-8-6-18(7-9-19)23(24)25)20-16(11-17)13-27-21(28-20)14-4-2-1-3-5-14/h1-11,21H,12-13H2/t21-/m0/s1 |
| InChIKey | BHDQFPZRJQYJDK-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|