C22H16FNO6 — CID 9454718
[(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl 2-nitrobenzoate (PubChem CID 9454718) has the molecular formula C22H16FNO6 and a molecular weight of 409.37 g/mol. Its IUPAC name is [(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl 2-nitrobenzoate.
| Compound Name | [(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 9454718 |
| Molecular Formula | C22H16FNO6 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [(2S)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl 2-nitrobenzoate |
| SMILES | O=C(OCc1cc(F)cc2c1O[C@@H](c1ccccc1)OC2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16FNO6/c23-17-10-15(12-28-21(25)18-8-4-5-9-19(18)24(26)27)20-16(11-17)13-29-22(30-20)14-6-2-1-3-7-14/h1-11,22H,12-13H2/t22-/m0/s1 |
| InChIKey | MPVXDUXEBFZHNM-QFIPXVFZSA-N |
| XLogP | 4.70 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|