C22H17FO4S — CID 8568083
[(2R)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 8568083) has the molecular formula C22H17FO4S and a molecular weight of 396.44 g/mol. Its IUPAC name is [(2R)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [(2R)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 8568083 |
| Molecular Formula | C22H17FO4S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [(2R)-6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl]methyl (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccsc1)OCc1cc(F)cc2c1O[C@H](c1ccccc1)OC2 |
| InChI | InChI=1S/C22H17FO4S/c23-19-10-17(12-25-20(24)7-6-15-8-9-28-14-15)21-18(11-19)13-26-22(27-21)16-4-2-1-3-5-16/h1-11,14,22H,12-13H2/b7-6+/t22-/m1/s1 |
| InChIKey | ZTOUZAPGXFWCKI-XYXUZSOXSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|