C23H19ClFNO5 — CID 16578281
(6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 16578281) has the molecular formula C23H19ClFNO5 and a molecular weight of 443.86 g/mol. Its IUPAC name is (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 16578281 |
| Molecular Formula | C23H19ClFNO5 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCc1cc(F)cc2c1OC(c1ccccc1)OC2 |
| InChI | InChI=1S/C23H19ClFNO5/c1-28-20-10-19(26)18(24)9-17(20)22(27)29-11-14-7-16(25)8-15-12-30-23(31-21(14)15)13-5-3-2-4-6-13/h2-10,23H,11-12,26H2,1H3 |
| InChIKey | WGTMWFJZANVHJV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|