C21H15F2NO5 — CID 9492647
(2R)-6-fluoro-8-[(5-fluoro-2-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine (PubChem CID 9492647) has the molecular formula C21H15F2NO5 and a molecular weight of 399.35 g/mol. Its IUPAC name is (2R)-6-fluoro-8-[(5-fluoro-2-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine.
| Compound Name | (2R)-6-fluoro-8-[(5-fluoro-2-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 9492647 |
| Molecular Formula | C21H15F2NO5 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (2R)-6-fluoro-8-[(5-fluoro-2-nitrophenoxy)methyl]-2-phenyl-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OCc1cc(F)cc2c1O[C@H](c1ccccc1)OC2 |
| InChI | InChI=1S/C21H15F2NO5/c22-16-6-7-18(24(25)26)19(10-16)27-11-14-8-17(23)9-15-12-28-21(29-20(14)15)13-4-2-1-3-5-13/h1-10,21H,11-12H2/t21-/m1/s1 |
| InChIKey | RBVASUAZMSDYBO-OAQYLSRUSA-N |
| XLogP | 5.06 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|