C15H9NO4 — CID 12776975
5-nitro-2-phenylindene-1,3-dione (PubChem CID 12776975) has the molecular formula C15H9NO4 and a molecular weight of 267.24 g/mol. Its IUPAC name is 5-nitro-2-phenylindene-1,3-dione.
| Compound Name | 5-nitro-2-phenylindene-1,3-dione |
|---|---|
| PubChem CID | 12776975 |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-nitro-2-phenylindene-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C15H9NO4/c17-14-11-7-6-10(16(19)20)8-12(11)15(18)13(14)9-4-2-1-3-5-9/h1-8,13H |
| InChIKey | VZHBATYTBJNLEA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|