C14H11N3O3 — CID 129390666
(2S)-6-nitro-2-phenyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 129390666) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2S)-6-nitro-2-phenyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2S)-6-nitro-2-phenyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 129390666 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (2S)-6-nitro-2-phenyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1N[C@@H](c2ccccc2)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H11N3O3/c18-14-11-8-10(17(19)20)6-7-12(11)15-13(16-14)9-4-2-1-3-5-9/h1-8,13,15H,(H,16,18)/t13-/m0/s1 |
| InChIKey | SNJWCDJROJUGJG-ZDUSSCGKSA-N |
| XLogP | 2.45 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|