C14H11N3O3 — CID 136834947
6-nitro-2-phenyl-1,2-dihydro-3,1-benzoxazin-4-imine (PubChem CID 136834947) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-nitro-2-phenyl-1,2-dihydro-3,1-benzoxazin-4-imine.
| Compound Name | 6-nitro-2-phenyl-1,2-dihydro-3,1-benzoxazin-4-imine |
|---|---|
| PubChem CID | 136834947 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-nitro-2-phenyl-1,2-dihydro-3,1-benzoxazin-4-imine |
| SMILES | [H]/N=C1\OC(c2ccccc2)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H11N3O3/c15-13-11-8-10(17(18)19)6-7-12(11)16-14(20-13)9-4-2-1-3-5-9/h1-8,14-16H/b15-13- |
| InChIKey | CAQQYKYVVHKIAW-SQFISAMPSA-N |
| XLogP | 3.06 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|