C14H10N2O4 — CID 52515478
(2R)-6-nitro-2-phenyl-4H-1,4-benzoxazin-3-one (PubChem CID 52515478) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2R)-6-nitro-2-phenyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2R)-6-nitro-2-phenyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 52515478 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R)-6-nitro-2-phenyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc([N+](=O)[O-])ccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H10N2O4/c17-14-13(9-4-2-1-3-5-9)20-12-7-6-10(16(18)19)8-11(12)15-14/h1-8,13H,(H,15,17)/t13-/m1/s1 |
| InChIKey | RMPWSUXKVXKBHS-CYBMUJFWSA-N |
| XLogP | 2.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|