C16H23N2O5Si — CID 70102641
CID 70102641 (PubChem CID 70102641) has the molecular formula C16H23N2O5Si and a molecular weight of 351.46 g/mol.
| Compound Name | CID 70102641 |
|---|---|
| PubChem CID | 70102641 |
| Molecular Formula | C16H23N2O5Si |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(CC(C)(C)C)C1Oc2ccc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C16H23N2O5Si/c1-16(2,3)9-13(23-24(4)5)14-15(19)17-11-8-10(18(20)21)6-7-12(11)22-14/h6-8,13-14H,9H2,1-5H3,(H,17,19) |
| InChIKey | QETBKBQOSTXMLV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|