C10H6F4N2O4 — CID 21462586
2,2-bis(difluoromethyl)-6-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 21462586) has the molecular formula C10H6F4N2O4 and a molecular weight of 294.16 g/mol. Its IUPAC name is 2,2-bis(difluoromethyl)-6-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 2,2-bis(difluoromethyl)-6-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 21462586 |
| Molecular Formula | C10H6F4N2O4 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,2-bis(difluoromethyl)-6-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc([N+](=O)[O-])ccc2OC1(C(F)F)C(F)F |
| InChI | InChI=1S/C10H6F4N2O4/c11-7(12)10(8(13)14)9(17)15-5-3-4(16(18)19)1-2-6(5)20-10/h1-3,7-8H,(H,15,17) |
| InChIKey | RPTIQCPSQFBNNP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|