C20H22N4O7 — CID 159613320
2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one;2,2-dimethyl-6-nitro-3,4-dihydro-1,4-benzoxazine (PubChem CID 159613320) has the molecular formula C20H22N4O7 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one;2,2-dimethyl-6-nitro-3,4-dihydro-1,4-benzoxazine.
| Compound Name | 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one;2,2-dimethyl-6-nitro-3,4-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 159613320 |
| Molecular Formula | C20H22N4O7 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2,2-dimethyl-6-nitro-4H-1,4-benzoxazin-3-one;2,2-dimethyl-6-nitro-3,4-dihydro-1,4-benzoxazine |
| SMILES | CC1(C)CNc2cc([N+](=O)[O-])ccc2O1.CC1(C)Oc2ccc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C10H10N2O4.C10H12N2O3/c1-10(2)9(13)11-7-5-6(12(14)15)3-4-8(7)16-10;1-10(2)6-11-8-5-7(12(13)14)3-4-9(8)15-10/h3-5H,1-2H3,(H,11,13);3-5,11H,6H2,1-2H3 |
| InChIKey | MMZCBKUOHBFSFJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|