C9H5F3N2O5 — CID 7013842
(2S)-2-hydroxy-6-nitro-2-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 7013842) has the molecular formula C9H5F3N2O5 and a molecular weight of 278.14 g/mol. Its IUPAC name is (2S)-2-hydroxy-6-nitro-2-(trifluoromethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2-hydroxy-6-nitro-2-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7013842 |
| Molecular Formula | C9H5F3N2O5 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (2S)-2-hydroxy-6-nitro-2-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc([N+](=O)[O-])ccc2O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C9H5F3N2O5/c10-9(11,12)8(16)7(15)13-5-3-4(14(17)18)1-2-6(5)19-8/h1-3,16H,(H,13,15)/t8-/m0/s1 |
| InChIKey | CATUPQKMCLYNGQ-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|