C9H3F6NO4 — CID 97109474
(2S)-2,4,4-trifluoro-6-nitro-2-(trifluoromethyl)-1,3-benzodioxine (PubChem CID 97109474) has the molecular formula C9H3F6NO4 and a molecular weight of 303.11 g/mol. Its IUPAC name is (2S)-2,4,4-trifluoro-6-nitro-2-(trifluoromethyl)-1,3-benzodioxine.
| Compound Name | (2S)-2,4,4-trifluoro-6-nitro-2-(trifluoromethyl)-1,3-benzodioxine |
|---|---|
| PubChem CID | 97109474 |
| Molecular Formula | C9H3F6NO4 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (2S)-2,4,4-trifluoro-6-nitro-2-(trifluoromethyl)-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(F)(F)O[C@](F)(C(F)(F)F)O2 |
| InChI | InChI=1S/C9H3F6NO4/c10-7(11)5-3-4(16(17)18)1-2-6(5)19-9(15,20-7)8(12,13)14/h1-3H/t9-/m0/s1 |
| InChIKey | IEXPAKCUULBXMM-VIFPVBQESA-N |
| XLogP | 3.24 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|