C17H7BrF3NO5 — CID 11503121
2-bromo-9-nitro-5a-(trifluoromethyl)chromeno[2,3-b]chromen-11-one (PubChem CID 11503121) has the molecular formula C17H7BrF3NO5 and a molecular weight of 442.14 g/mol. Its IUPAC name is 2-bromo-9-nitro-5a-(trifluoromethyl)chromeno[2,3-b]chromen-11-one.
| Compound Name | 2-bromo-9-nitro-5a-(trifluoromethyl)chromeno[2,3-b]chromen-11-one |
|---|---|
| PubChem CID | 11503121 |
| Molecular Formula | C17H7BrF3NO5 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 440.95 |
| IUPAC Name | 2-bromo-9-nitro-5a-(trifluoromethyl)chromeno[2,3-b]chromen-11-one |
| SMILES | O=C1C2=Cc3cc(Br)ccc3OC2(C(F)(F)F)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H7BrF3NO5/c18-9-1-3-13-8(5-9)6-12-15(23)11-7-10(22(24)25)2-4-14(11)27-16(12,26-13)17(19,20)21/h1-7H |
| InChIKey | OYTQKPKBTNXCHV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|