C12H13NO4 — CID 19387194
2,2,3-trimethyl-6-nitro-3H-chromen-4-one (PubChem CID 19387194) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2,2,3-trimethyl-6-nitro-3H-chromen-4-one.
| Compound Name | 2,2,3-trimethyl-6-nitro-3H-chromen-4-one |
|---|---|
| PubChem CID | 19387194 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2,2,3-trimethyl-6-nitro-3H-chromen-4-one |
| SMILES | CC1C(=O)c2cc([N+](=O)[O-])ccc2OC1(C)C |
| InChI | InChI=1S/C12H13NO4/c1-7-11(14)9-6-8(13(15)16)4-5-10(9)17-12(7,2)3/h4-7H,1-3H3 |
| InChIKey | IZUGWWUDDTWJGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|