C13H18N2O4 — CID 54363446
(3R,4S)-4-(dimethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 54363446) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is (3R,4S)-4-(dimethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-4-(dimethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 54363446 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (3R,4S)-4-(dimethylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CN(C)[C@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C13H18N2O4/c1-13(2)12(16)11(14(3)4)9-7-8(15(17)18)5-6-10(9)19-13/h5-7,11-12,16H,1-4H3/t11-,12+/m0/s1 |
| InChIKey | UOCJIEOZSXAORV-NWDGAFQWSA-N |
| XLogP | 1.73 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|