C17H19N3O4 — CID 91574773
(3R,4S)-4-(2-aminoanilino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 91574773) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is (3R,4S)-4-(2-aminoanilino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-4-(2-aminoanilino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 91574773 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3R,4S)-4-(2-aminoanilino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](Nc2ccccc2N)[C@H]1O |
| InChI | InChI=1S/C17H19N3O4/c1-17(2)16(21)15(19-13-6-4-3-5-12(13)18)11-9-10(20(22)23)7-8-14(11)24-17/h3-9,15-16,19,21H,18H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | QYIJCFLXFFEQBJ-JKSUJKDBSA-N |
| XLogP | 2.86 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|