C20H24N2O8 — CID 69220917
(2R,3R,4S)-2-(dimethoxymethyl)-4-(2-hydroxy-5-methoxyanilino)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 69220917) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is (2R,3R,4S)-2-(dimethoxymethyl)-4-(2-hydroxy-5-methoxyanilino)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2R,3R,4S)-2-(dimethoxymethyl)-4-(2-hydroxy-5-methoxyanilino)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 69220917 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2R,3R,4S)-2-(dimethoxymethyl)-4-(2-hydroxy-5-methoxyanilino)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COc1ccc(O)c(N[C@H]2c3cc([N+](=O)[O-])ccc3O[C@@](C)(C(OC)OC)[C@@H]2O)c1 |
| InChI | InChI=1S/C20H24N2O8/c1-20(19(28-3)29-4)18(24)17(21-14-10-12(27-2)6-7-15(14)23)13-9-11(22(25)26)5-8-16(13)30-20/h5-10,17-19,21,23-24H,1-4H3/t17-,18+,20+/m0/s1 |
| InChIKey | PXRYOCKRDFYEDV-NLWGTHIKSA-N |
| XLogP | 2.59 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|