C26H32N2O9 — CID 10142566
propyl (2R)-1-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-5-methoxy-2,3-dihydroindole-2-carboxylate (PubChem CID 10142566) has the molecular formula C26H32N2O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is propyl (2R)-1-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-5-methoxy-2,3-dihydroindole-2-carboxylate.
| Compound Name | propyl (2R)-1-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-5-methoxy-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 10142566 |
| Molecular Formula | C26H32N2O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | propyl (2R)-1-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-5-methoxy-2,3-dihydroindole-2-carboxylate |
| SMILES | CCCOC(=O)[C@H]1Cc2cc(OC)ccc2N1[C@H]1c2cc([N+](=O)[O-])ccc2O[C@@](C)(C(OC)OC)[C@@H]1O |
| InChI | InChI=1S/C26H32N2O9/c1-6-11-36-24(30)20-13-15-12-17(33-3)8-9-19(15)27(20)22-18-14-16(28(31)32)7-10-21(18)37-26(2,23(22)29)25(34-4)35-5/h7-10,12,14,20,22-23,25,29H,6,11,13H2,1-5H3/t20-,22+,23-,26-/m1/s1 |
| InChIKey | NGSHVHXSJFDYFP-PCEGQDSGSA-N |
| XLogP | 3.16 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|