C22H25ClN2O7 — CID 10115784
(2S,3R,4S)-4-[(2S)-5-chloro-2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 10115784) has the molecular formula C22H25ClN2O7 and a molecular weight of 464.90 g/mol. Its IUPAC name is (2S,3R,4S)-4-[(2S)-5-chloro-2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3R,4S)-4-[(2S)-5-chloro-2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 10115784 |
| Molecular Formula | C22H25ClN2O7 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (2S,3R,4S)-4-[(2S)-5-chloro-2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](N2c3ccc(Cl)cc3C[C@H]2CO)[C@H]1O |
| InChI | InChI=1S/C22H25ClN2O7/c1-22(21(30-2)31-3)20(27)19(16-10-14(25(28)29)5-7-18(16)32-22)24-15(11-26)9-12-8-13(23)4-6-17(12)24/h4-8,10,15,19-21,26-27H,9,11H2,1-3H3/t15-,19-,20+,22-/m0/s1 |
| InChIKey | CTBFXKSAPNSKEQ-KJLVNVKXSA-N |
| XLogP | 2.84 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|