C23H24N2O7 — CID 10225250
(2R,10R,11R)-10-(dimethoxymethyl)-10-methyl-5-nitro-9,12-dioxa-1-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3(8),4,6,17,19,21-hexaen-13-one (PubChem CID 10225250) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is (2R,10R,11R)-10-(dimethoxymethyl)-10-methyl-5-nitro-9,12-dioxa-1-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3(8),4,6,17,19,21-hexaen-13-one.
| Compound Name | (2R,10R,11R)-10-(dimethoxymethyl)-10-methyl-5-nitro-9,12-dioxa-1-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3(8),4,6,17,19,21-hexaen-13-one |
|---|---|
| PubChem CID | 10225250 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2R,10R,11R)-10-(dimethoxymethyl)-10-methyl-5-nitro-9,12-dioxa-1-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3(8),4,6,17,19,21-hexaen-13-one |
| SMILES | COC(OC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H]2[C@H]1OC(=O)C1CCc3ccccc3N12 |
| InChI | InChI=1S/C23H24N2O7/c1-23(22(29-2)30-3)20-19(15-12-14(25(27)28)9-11-18(15)32-23)24-16-7-5-4-6-13(16)8-10-17(24)21(26)31-20/h4-7,9,11-12,17,19-20,22H,8,10H2,1-3H3/t17?,19-,20-,23-/m1/s1 |
| InChIKey | ZNNJJDRXHDDHPD-XAMBIUOZSA-N |
| XLogP | 3.15 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|