C23H26N2O8 — CID 10139296
methyl (2S)-1-[(2S,3S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-2,3-dihydroindole-2-carboxylate (PubChem CID 10139296) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is methyl (2S)-1-[(2S,3S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2S,3S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 10139296 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl (2S)-1-[(2S,3S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccccc2N1C1c2cc([N+](=O)[O-])ccc2O[C@](C)(C(OC)OC)[C@H]1O |
| InChI | InChI=1S/C23H26N2O8/c1-23(22(31-3)32-4)20(26)19(15-12-14(25(28)29)9-10-18(15)33-23)24-16-8-6-5-7-13(16)11-17(24)21(27)30-2/h5-10,12,17,19-20,22,26H,11H2,1-4H3/t17-,19?,20-,23-/m0/s1 |
| InChIKey | YSLHONSEBMGWBG-CTLPNWKNSA-N |
| XLogP | 2.37 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|