C13H18N2O6 — CID 18351891
4-amino-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 18351891) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-amino-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | 4-amino-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 18351891 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-amino-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)C1(C)Oc2ccc([N+](=O)[O-])cc2C(N)C1O |
| InChI | InChI=1S/C13H18N2O6/c1-13(12(19-2)20-3)11(16)10(14)8-6-7(15(17)18)4-5-9(8)21-13/h4-6,10-12,16H,14H2,1-3H3 |
| InChIKey | QGLRJCXMTJXHAO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|