C11H14N2O4 — CID 54090204
(3R,4S)-4-amino-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol (PubChem CID 54090204) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (3R,4S)-4-amino-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-4-amino-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 54090204 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (3R,4S)-4-amino-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])ccc2[C@H](N)[C@H]1O |
| InChI | InChI=1S/C11H14N2O4/c1-11(2)10(14)9(12)7-4-3-6(13(15)16)5-8(7)17-11/h3-5,9-10,14H,12H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | MTHUMMQYWMNDJF-VHSXEESVSA-N |
| XLogP | 1.13 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|