C19H21N3O6 — CID 54498060
1-amino-6-nitro-2,3-dihydro-1H-inden-2-ol;1-methyl-6-nitro-2,3-dihydro-1H-inden-2-ol (PubChem CID 54498060) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-amino-6-nitro-2,3-dihydro-1H-inden-2-ol;1-methyl-6-nitro-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-amino-6-nitro-2,3-dihydro-1H-inden-2-ol;1-methyl-6-nitro-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 54498060 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-amino-6-nitro-2,3-dihydro-1H-inden-2-ol;1-methyl-6-nitro-2,3-dihydro-1H-inden-2-ol |
| SMILES | CC1c2cc([N+](=O)[O-])ccc2CC1O.NC1c2cc([N+](=O)[O-])ccc2CC1O |
| InChI | InChI=1S/C10H11NO3.C9H10N2O3/c1-6-9-5-8(11(13)14)3-2-7(9)4-10(6)12;10-9-7-4-6(11(13)14)2-1-5(7)3-8(9)12/h2-3,5-6,10,12H,4H2,1H3;1-2,4,8-9,12H,3,10H2 |
| InChIKey | YANCXWITHZQGNH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|