C10H11NO3 — CID 142039244
2-methyl-6-nitro-2,3-dihydro-1H-inden-1-ol (PubChem CID 142039244) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-methyl-6-nitro-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-methyl-6-nitro-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 142039244 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-methyl-6-nitro-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC1Cc2ccc([N+](=O)[O-])cc2C1O |
| InChI | InChI=1S/C10H11NO3/c1-6-4-7-2-3-8(11(13)14)5-9(7)10(6)12/h2-3,5-6,10,12H,4H2,1H3 |
| InChIKey | HBNXHZQINPYOPH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|