C16H20N2O6 — CID 91100420
(3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 91100420) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | (3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 91100420 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | C[C@H]1Cc2ccc([N+](=O)[O-])cc2C(C(=O)O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20N2O6/c1-9-7-10-5-6-11(18(22)23)8-12(10)13(14(19)20)17(9)15(21)24-16(2,3)4/h5-6,8-9,13H,7H2,1-4H3,(H,19,20)/t9-,13?/m0/s1 |
| InChIKey | KEABTKLSXNKSFX-LLTODGECSA-N |
| XLogP | 2.90 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|