C15H20N2O4 — CID 50999112
tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate (PubChem CID 50999112) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 50999112 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H20N2O4/c1-14(2,3)21-13(18)16-9-15(4,5)11-7-6-10(17(19)20)8-12(11)16/h6-8H,9H2,1-5H3 |
| InChIKey | LXCSKRDBTOIEGW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|