C16H22N2O4 — CID 57470253
tert-butyl 4,4-dimethyl-7-nitro-2,3-dihydroquinoline-1-carboxylate (PubChem CID 57470253) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl 4,4-dimethyl-7-nitro-2,3-dihydroquinoline-1-carboxylate.
| Compound Name | tert-butyl 4,4-dimethyl-7-nitro-2,3-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 57470253 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl 4,4-dimethyl-7-nitro-2,3-dihydroquinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(C)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H22N2O4/c1-15(2,3)22-14(19)17-9-8-16(4,5)12-7-6-11(18(20)21)10-13(12)17/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | BTIAANPSPUZUTF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|