C16H18N2O5 — CID 118186268
tert-butyl 5'-nitro-2'-oxospiro[cyclobutane-1,3'-indole]-1'-carboxylate (PubChem CID 118186268) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is tert-butyl 5'-nitro-2'-oxospiro[cyclobutane-1,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl 5'-nitro-2'-oxospiro[cyclobutane-1,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 118186268 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | tert-butyl 5'-nitro-2'-oxospiro[cyclobutane-1,3'-indole]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2(CCC2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H18N2O5/c1-15(2,3)23-14(20)17-12-6-5-10(18(21)22)9-11(12)16(13(17)19)7-4-8-16/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | BLTVUTXAPZJMBD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|