C17H22N2O3 — CID 69184428
tert-butyl 2-oxospiro[indole-3,4'-piperidine]-1-carboxylate (PubChem CID 69184428) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl 2-oxospiro[indole-3,4'-piperidine]-1-carboxylate.
| Compound Name | tert-butyl 2-oxospiro[indole-3,4'-piperidine]-1-carboxylate |
|---|---|
| PubChem CID | 69184428 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | tert-butyl 2-oxospiro[indole-3,4'-piperidine]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C17H22N2O3/c1-16(2,3)22-15(21)19-13-7-5-4-6-12(13)17(14(19)20)8-10-18-11-9-17/h4-7,18H,8-11H2,1-3H3 |
| InChIKey | WXLLNTNLOSNJRR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |