C22H21N3O3 — CID 68815259
1-(6-methoxy-1H-indole-2-carbonyl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 68815259) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(6-methoxy-1H-indole-2-carbonyl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-(6-methoxy-1H-indole-2-carbonyl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 68815259 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(6-methoxy-1H-indole-2-carbonyl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | COc1ccc2cc(C(=O)N3C(=O)C4(CCNCC4)c4ccccc43)[nH]c2c1 |
| InChI | InChI=1S/C22H21N3O3/c1-28-15-7-6-14-12-18(24-17(14)13-15)20(26)25-19-5-3-2-4-16(19)22(21(25)27)8-10-23-11-9-22/h2-7,12-13,23-24H,8-11H2,1H3 |
| InChIKey | FTCZICJEEXGVJC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|