C30H25N5O6 — CID 155932296
tert-butyl (3R,3'R,5'R)-4',4'-dicyano-1'-hydroxy-3'-(3-nitrophenyl)-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate (PubChem CID 155932296) has the molecular formula C30H25N5O6 and a molecular weight of 551.56 g/mol. Its IUPAC name is tert-butyl (3R,3'R,5'R)-4',4'-dicyano-1'-hydroxy-3'-(3-nitrophenyl)-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate.
| Compound Name | tert-butyl (3R,3'R,5'R)-4',4'-dicyano-1'-hydroxy-3'-(3-nitrophenyl)-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
|---|---|
| PubChem CID | 155932296 |
| Molecular Formula | C30H25N5O6 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | tert-butyl (3R,3'R,5'R)-4',4'-dicyano-1'-hydroxy-3'-(3-nitrophenyl)-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@]2(c3ccccc31)[C@H](c1cccc([N+](=O)[O-])c1)C(C#N)(C#N)[C@@H](c1ccccc1)N2O |
| InChI | InChI=1S/C30H25N5O6/c1-28(2,3)41-27(37)33-23-15-8-7-14-22(23)30(26(33)36)24(20-12-9-13-21(16-20)35(39)40)29(17-31,18-32)25(34(30)38)19-10-5-4-6-11-19/h4-16,24-25,38H,1-3H3/t24-,25-,30+/m1/s1 |
| InChIKey | VXCKMYIXFUAKIC-KQZWIPHESA-N |
| XLogP | 5.34 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|