C30H25ClN4O4 — CID 155932288
tert-butyl (3R,3'R,5'R)-5-chloro-4',4'-dicyano-1'-hydroxy-2-oxo-3',5'-diphenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate (PubChem CID 155932288) has the molecular formula C30H25ClN4O4 and a molecular weight of 541.01 g/mol. Its IUPAC name is tert-butyl (3R,3'R,5'R)-5-chloro-4',4'-dicyano-1'-hydroxy-2-oxo-3',5'-diphenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate.
| Compound Name | tert-butyl (3R,3'R,5'R)-5-chloro-4',4'-dicyano-1'-hydroxy-2-oxo-3',5'-diphenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
|---|---|
| PubChem CID | 155932288 |
| Molecular Formula | C30H25ClN4O4 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | tert-butyl (3R,3'R,5'R)-5-chloro-4',4'-dicyano-1'-hydroxy-2-oxo-3',5'-diphenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@]2(c3cc(Cl)ccc31)[C@H](c1ccccc1)C(C#N)(C#N)[C@@H](c1ccccc1)N2O |
| InChI | InChI=1S/C30H25ClN4O4/c1-28(2,3)39-27(37)34-23-15-14-21(31)16-22(23)30(26(34)36)24(19-10-6-4-7-11-19)29(17-32,18-33)25(35(30)38)20-12-8-5-9-13-20/h4-16,24-25,38H,1-3H3/t24-,25-,30+/m1/s1 |
| InChIKey | NDCXIGRKMRBRMR-KQZWIPHESA-N |
| XLogP | 6.08 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |