C15H16ClN3O3 — CID 102430954
tert-butyl N-(5-chloro-3-cyano-1-methyl-2-oxoindol-3-yl)carbamate (PubChem CID 102430954) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-3-cyano-1-methyl-2-oxoindol-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-3-cyano-1-methyl-2-oxoindol-3-yl)carbamate |
|---|---|
| PubChem CID | 102430954 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | tert-butyl N-(5-chloro-3-cyano-1-methyl-2-oxoindol-3-yl)carbamate |
| SMILES | CN1C(=O)C(C#N)(NC(=O)OC(C)(C)C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H16ClN3O3/c1-14(2,3)22-13(21)18-15(8-17)10-7-9(16)5-6-11(10)19(4)12(15)20/h5-7H,1-4H3,(H,18,21) |
| InChIKey | QCBWVPPZXAALIE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |