C17H22N2O4 — CID 102106113
tert-butyl N-[(3R)-1-methyl-2-oxo-3-prop-2-enoxyindol-3-yl]carbamate (PubChem CID 102106113) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-methyl-2-oxo-3-prop-2-enoxyindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-methyl-2-oxo-3-prop-2-enoxyindol-3-yl]carbamate |
|---|---|
| PubChem CID | 102106113 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl N-[(3R)-1-methyl-2-oxo-3-prop-2-enoxyindol-3-yl]carbamate |
| SMILES | C=CCO[C@@]1(NC(=O)OC(C)(C)C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C17H22N2O4/c1-6-11-22-17(18-15(21)23-16(2,3)4)12-9-7-8-10-13(12)19(5)14(17)20/h6-10H,1,11H2,2-5H3,(H,18,21)/t17-/m1/s1 |
| InChIKey | OHJFLUHCVVATEN-QGZVFWFLSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|