C22H25ClN2O3S — CID 146166823
tert-butyl N-[3-(4-chlorophenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate (PubChem CID 146166823) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chlorophenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chlorophenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate |
|---|---|
| PubChem CID | 146166823 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | tert-butyl N-[3-(4-chlorophenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate |
| SMILES | CCCN1C(=O)C(NC(=O)OC(C)(C)C)(Sc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-5-14-25-18-9-7-6-8-17(18)22(19(25)26,24-20(27)28-21(2,3)4)29-16-12-10-15(23)11-13-16/h6-13H,5,14H2,1-4H3,(H,24,27) |
| InChIKey | SJYAWZXUHVGQOD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|