C23H28N2O3 — CID 122496564
tert-butyl (3R)-3-(butylamino)-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 122496564) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl (3R)-3-(butylamino)-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(butylamino)-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 122496564 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl (3R)-3-(butylamino)-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CCCCN[C@@]1(c2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C23H28N2O3/c1-5-6-16-24-23(17-12-8-7-9-13-17)18-14-10-11-15-19(18)25(20(23)26)21(27)28-22(2,3)4/h7-15,24H,5-6,16H2,1-4H3/t23-/m1/s1 |
| InChIKey | ZTUKMGUGPINDFR-HSZRJFAPSA-N |
| XLogP | 4.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|