C25H27NO3 — CID 162678728
tert-butyl (3R)-3-methyl-2-oxo-3-[(3S)-1-phenylpent-1-yn-3-yl]indole-1-carboxylate (PubChem CID 162678728) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl (3R)-3-methyl-2-oxo-3-[(3S)-1-phenylpent-1-yn-3-yl]indole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-methyl-2-oxo-3-[(3S)-1-phenylpent-1-yn-3-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 162678728 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl (3R)-3-methyl-2-oxo-3-[(3S)-1-phenylpent-1-yn-3-yl]indole-1-carboxylate |
| SMILES | CC[C@@H](C#Cc1ccccc1)[C@@]1(C)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C25H27NO3/c1-6-19(17-16-18-12-8-7-9-13-18)25(5)20-14-10-11-15-21(20)26(22(25)27)23(28)29-24(2,3)4/h7-15,19H,6H2,1-5H3/t19-,25+/m0/s1 |
| InChIKey | TXUTXNFELKUEJJ-UQBPGWFLSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|