C26H31N3O7 — CID 44557496
tert-butyl 3-benzyl-3-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-oxoindole-1-carboxylate (PubChem CID 44557496) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is tert-butyl 3-benzyl-3-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl 3-benzyl-3-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 44557496 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl 3-benzyl-3-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-oxoindole-1-carboxylate |
| SMILES | CCOC(=O)NN(C(=O)OCC)C1(Cc2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C26H31N3O7/c1-6-34-22(31)27-29(24(33)35-7-2)26(17-18-13-9-8-10-14-18)19-15-11-12-16-20(19)28(21(26)30)23(32)36-25(3,4)5/h8-16H,6-7,17H2,1-5H3,(H,27,31) |
| InChIKey | PYHXATWDXYQPDW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|