C32H31NO4 — CID 71680995
tert-butyl (3S)-3-benzyl-3-[(1R,3E)-3-benzylidene-4-oxocyclopentyl]-2-oxoindole-1-carboxylate (PubChem CID 71680995) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl (3S)-3-benzyl-3-[(1R,3E)-3-benzylidene-4-oxocyclopentyl]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-benzyl-3-[(1R,3E)-3-benzylidene-4-oxocyclopentyl]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 71680995 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | tert-butyl (3S)-3-benzyl-3-[(1R,3E)-3-benzylidene-4-oxocyclopentyl]-2-oxoindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@](Cc2ccccc2)([C@H]2CC(=O)/C(=C/c3ccccc3)C2)c2ccccc21 |
| InChI | InChI=1S/C32H31NO4/c1-31(2,3)37-30(36)33-27-17-11-10-16-26(27)32(29(33)35,21-23-14-8-5-9-15-23)25-19-24(28(34)20-25)18-22-12-6-4-7-13-22/h4-18,25H,19-21H2,1-3H3/b24-18+/t25-,32+/m1/s1 |
| InChIKey | PVFLGQXGBFINSZ-DAAHAPAQSA-N |
| XLogP | 6.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|