C25H29N3O5 — CID 44556796
ethyl N-[(3S)-1-benzyl-3-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-N-(ethoxycarbonylamino)carbamate (PubChem CID 44556796) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is ethyl N-[(3S)-1-benzyl-3-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-[(3S)-1-benzyl-3-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 44556796 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl N-[(3S)-1-benzyl-3-(2-methylprop-2-enyl)-2-oxoindol-3-yl]-N-(ethoxycarbonylamino)carbamate |
| SMILES | C=C(C)C[C@@]1(N(NC(=O)OCC)C(=O)OCC)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H29N3O5/c1-5-32-23(30)26-28(24(31)33-6-2)25(16-18(3)4)20-14-10-11-15-21(20)27(22(25)29)17-19-12-8-7-9-13-19/h7-15H,3,5-6,16-17H2,1-2,4H3,(H,26,30)/t25-/m0/s1 |
| InChIKey | SFXPBNQBDIVFMH-VWLOTQADSA-N |
| XLogP | 4.51 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|