C31H24N2O3 — CID 102359583
benzyl N-[(3R)-1-benzyl-2-oxo-3-(2-phenylethynyl)indol-3-yl]carbamate (PubChem CID 102359583) has the molecular formula C31H24N2O3 and a molecular weight of 472.54 g/mol. Its IUPAC name is benzyl N-[(3R)-1-benzyl-2-oxo-3-(2-phenylethynyl)indol-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-1-benzyl-2-oxo-3-(2-phenylethynyl)indol-3-yl]carbamate |
|---|---|
| PubChem CID | 102359583 |
| Molecular Formula | C31H24N2O3 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | benzyl N-[(3R)-1-benzyl-2-oxo-3-(2-phenylethynyl)indol-3-yl]carbamate |
| SMILES | O=C(N[C@@]1(C#Cc2ccccc2)C(=O)N(Cc2ccccc2)c2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C31H24N2O3/c34-29-31(21-20-24-12-4-1-5-13-24,32-30(35)36-23-26-16-8-3-9-17-26)27-18-10-11-19-28(27)33(29)22-25-14-6-2-7-15-25/h1-19H,22-23H2,(H,32,35)/t31-/m1/s1 |
| InChIKey | AMYYLEWWNMYHIZ-WJOKGBTCSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|