C27H25ClN2O2S — CID 57382124
(R)-N-[(3R)-1-benzyl-4-chloro-2-oxo-3-(2-phenylethynyl)indol-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 57382124) has the molecular formula C27H25ClN2O2S and a molecular weight of 477.03 g/mol. Its IUPAC name is (R)-N-[(3R)-1-benzyl-4-chloro-2-oxo-3-(2-phenylethynyl)indol-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3R)-1-benzyl-4-chloro-2-oxo-3-(2-phenylethynyl)indol-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 57382124 |
| Molecular Formula | C27H25ClN2O2S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (R)-N-[(3R)-1-benzyl-4-chloro-2-oxo-3-(2-phenylethynyl)indol-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@]1(C#Cc2ccccc2)C(=O)N(Cc2ccccc2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C27H25ClN2O2S/c1-26(2,3)33(32)29-27(18-17-20-11-6-4-7-12-20)24-22(28)15-10-16-23(24)30(25(27)31)19-21-13-8-5-9-14-21/h4-16,29H,19H2,1-3H3/t27-,33-/m1/s1 |
| InChIKey | IFAJHXAMZOKWTQ-ZORMNXRFSA-N |
| XLogP | 5.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|