C28H21NO3 — CID 134845634
1-benzyl-3-hydroxy-3-[2-(5-methoxynaphthalen-2-yl)ethynyl]indol-2-one (PubChem CID 134845634) has the molecular formula C28H21NO3 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-benzyl-3-hydroxy-3-[2-(5-methoxynaphthalen-2-yl)ethynyl]indol-2-one.
| Compound Name | 1-benzyl-3-hydroxy-3-[2-(5-methoxynaphthalen-2-yl)ethynyl]indol-2-one |
|---|---|
| PubChem CID | 134845634 |
| Molecular Formula | C28H21NO3 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-benzyl-3-hydroxy-3-[2-(5-methoxynaphthalen-2-yl)ethynyl]indol-2-one |
| SMILES | COc1cccc2cc(C#CC3(O)C(=O)N(Cc4ccccc4)c4ccccc43)ccc12 |
| InChI | InChI=1S/C28H21NO3/c1-32-26-13-7-10-22-18-20(14-15-23(22)26)16-17-28(31)24-11-5-6-12-25(24)29(27(28)30)19-21-8-3-2-4-9-21/h2-15,18,31H,19H2,1H3 |
| InChIKey | YNPLANPNUGGPSC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|