C24H18ClNO2 — CID 102365931
1-benzyl-5-chloro-3-hydroxy-3-[2-(4-methylphenyl)ethynyl]indol-2-one (PubChem CID 102365931) has the molecular formula C24H18ClNO2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-hydroxy-3-[2-(4-methylphenyl)ethynyl]indol-2-one.
| Compound Name | 1-benzyl-5-chloro-3-hydroxy-3-[2-(4-methylphenyl)ethynyl]indol-2-one |
|---|---|
| PubChem CID | 102365931 |
| Molecular Formula | C24H18ClNO2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-benzyl-5-chloro-3-hydroxy-3-[2-(4-methylphenyl)ethynyl]indol-2-one |
| SMILES | Cc1ccc(C#CC2(O)C(=O)N(Cc3ccccc3)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C24H18ClNO2/c1-17-7-9-18(10-8-17)13-14-24(28)21-15-20(25)11-12-22(21)26(23(24)27)16-19-5-3-2-4-6-19/h2-12,15,28H,16H2,1H3 |
| InChIKey | VSYLYINMLYGMKZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|