C19H18ClNO2 — CID 162398533
1-benzyl-6-chloro-3-hydroxy-3-(2-methylprop-2-enyl)indol-2-one (PubChem CID 162398533) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-benzyl-6-chloro-3-hydroxy-3-(2-methylprop-2-enyl)indol-2-one.
| Compound Name | 1-benzyl-6-chloro-3-hydroxy-3-(2-methylprop-2-enyl)indol-2-one |
|---|---|
| PubChem CID | 162398533 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-benzyl-6-chloro-3-hydroxy-3-(2-methylprop-2-enyl)indol-2-one |
| SMILES | C=C(C)CC1(O)C(=O)N(Cc2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H18ClNO2/c1-13(2)11-19(23)16-9-8-15(20)10-17(16)21(18(19)22)12-14-6-4-3-5-7-14/h3-10,23H,1,11-12H2,2H3 |
| InChIKey | NBRIBFGBCJOXQN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|